C11H10F2N2O2S2 — CID 106058021
5-(aminomethyl)-N-(2,5-difluorophenyl)thiophene-3-sulfonamide (PubChem CID 106058021) has the molecular formula C11H10F2N2O2S2 and a molecular weight of 304.34 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,5-difluorophenyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,5-difluorophenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106058021 |
| Molecular Formula | C11H10F2N2O2S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5-(aminomethyl)-N-(2,5-difluorophenyl)thiophene-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2cc(F)ccc2F)cs1 |
| InChI | InChI=1S/C11H10F2N2O2S2/c12-7-1-2-10(13)11(3-7)15-19(16,17)9-4-8(5-14)18-6-9/h1-4,6,15H,5,14H2 |
| InChIKey | JOKRLYWAJIRYAR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |