C10H17BrN2O2S3 — CID 106084006
5-(aminomethyl)-2-bromo-N-(1-methylsulfanylbutan-2-yl)thiophene-3-sulfonamide (PubChem CID 106084006) has the molecular formula C10H17BrN2O2S3 and a molecular weight of 373.36 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(1-methylsulfanylbutan-2-yl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(1-methylsulfanylbutan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106084006 |
| Molecular Formula | C10H17BrN2O2S3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(1-methylsulfanylbutan-2-yl)thiophene-3-sulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1cc(CN)sc1Br |
| InChI | InChI=1S/C10H17BrN2O2S3/c1-3-7(6-16-2)13-18(14,15)9-4-8(5-12)17-10(9)11/h4,7,13H,3,5-6,12H2,1-2H3 |
| InChIKey | IPTJISVKINQULI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |