C10H10BrN5O2S — CID 116787819
5-bromo-2-(methylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide (PubChem CID 116787819) has the molecular formula C10H10BrN5O2S and a molecular weight of 344.19 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(methylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 116787819 |
| Molecular Formula | C10H10BrN5O2S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-pyridazin-3-ylpyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)Nc1cccnn1 |
| InChI | InChI=1S/C10H10BrN5O2S/c1-12-10-8(5-7(11)6-13-10)19(17,18)16-9-3-2-4-14-15-9/h2-6H,1H3,(H,12,13)(H,15,16) |
| InChIKey | IXBJBMQOQHLSKX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |