C12H10Br2ClN3O2S — CID 81280690
5-bromo-N-(2-bromo-4-chlorophenyl)-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 81280690) has the molecular formula C12H10Br2ClN3O2S and a molecular weight of 455.56 g/mol. Its IUPAC name is 5-bromo-N-(2-bromo-4-chlorophenyl)-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(2-bromo-4-chlorophenyl)-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 81280690 |
| Molecular Formula | C12H10Br2ClN3O2S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 452.85 |
| IUPAC Name | 5-bromo-N-(2-bromo-4-chlorophenyl)-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)Nc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H10Br2ClN3O2S/c1-16-12-11(4-7(13)6-17-12)21(19,20)18-10-3-2-8(15)5-9(10)14/h2-6,18H,1H3,(H,16,17) |
| InChIKey | VAHJDCOQRUYVSN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |