C11H9BrClFN2O3S — CID 106030356
5-(aminomethyl)-2-bromo-N-(5-chloro-2-fluorophenyl)furan-3-sulfonamide (PubChem CID 106030356) has the molecular formula C11H9BrClFN2O3S and a molecular weight of 383.63 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(5-chloro-2-fluorophenyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(5-chloro-2-fluorophenyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106030356 |
| Molecular Formula | C11H9BrClFN2O3S |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(5-chloro-2-fluorophenyl)furan-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2cc(Cl)ccc2F)c(Br)o1 |
| InChI | InChI=1S/C11H9BrClFN2O3S/c12-11-10(4-7(5-15)19-11)20(17,18)16-9-3-6(13)1-2-8(9)14/h1-4,16H,5,15H2 |
| InChIKey | GASHEOZHAGFPQM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |