C12H10Cl3NO4S — CID 107553261
5-(hydroxymethyl)-2-methyl-N-(2,4,5-trichlorophenyl)furan-3-sulfonamide (PubChem CID 107553261) has the molecular formula C12H10Cl3NO4S and a molecular weight of 370.64 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-(2,4,5-trichlorophenyl)furan-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-(2,4,5-trichlorophenyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 107553261 |
| Molecular Formula | C12H10Cl3NO4S |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-(2,4,5-trichlorophenyl)furan-3-sulfonamide |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl3NO4S/c1-6-12(2-7(5-17)20-6)21(18,19)16-11-4-9(14)8(13)3-10(11)15/h2-4,16-17H,5H2,1H3 |
| InChIKey | YQJARUVDQVCCDM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|