C12H11BrClNO4S — CID 107309159
2-bromo-N-(3-chloro-2-methylphenyl)-5-(hydroxymethyl)furan-3-sulfonamide (PubChem CID 107309159) has the molecular formula C12H11BrClNO4S and a molecular weight of 380.65 g/mol. Its IUPAC name is 2-bromo-N-(3-chloro-2-methylphenyl)-5-(hydroxymethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-N-(3-chloro-2-methylphenyl)-5-(hydroxymethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 107309159 |
| Molecular Formula | C12H11BrClNO4S |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 2-bromo-N-(3-chloro-2-methylphenyl)-5-(hydroxymethyl)furan-3-sulfonamide |
| SMILES | Cc1c(Cl)cccc1NS(=O)(=O)c1cc(CO)oc1Br |
| InChI | InChI=1S/C12H11BrClNO4S/c1-7-9(14)3-2-4-10(7)15-20(17,18)11-5-8(6-16)19-12(11)13/h2-5,15-16H,6H2,1H3 |
| InChIKey | QJLFGBJZWMXMDV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |