C12H11BrClFN2O3S — CID 106087695
5-(aminomethyl)-N-(2-bromo-6-chloro-4-fluorophenyl)-2-methylfuran-3-sulfonamide (PubChem CID 106087695) has the molecular formula C12H11BrClFN2O3S and a molecular weight of 397.65 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-bromo-6-chloro-4-fluorophenyl)-2-methylfuran-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-bromo-6-chloro-4-fluorophenyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106087695 |
| Molecular Formula | C12H11BrClFN2O3S |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 5-(aminomethyl)-N-(2-bromo-6-chloro-4-fluorophenyl)-2-methylfuran-3-sulfonamide |
| SMILES | Cc1oc(CN)cc1S(=O)(=O)Nc1c(Cl)cc(F)cc1Br |
| InChI | InChI=1S/C12H11BrClFN2O3S/c1-6-11(4-8(5-16)20-6)21(18,19)17-12-9(13)2-7(15)3-10(12)14/h2-4,17H,5,16H2,1H3 |
| InChIKey | OIFCMOQCGPYVJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |