C12H12BrFN2O3S — CID 106067078
5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)-2-methylfuran-3-sulfonamide (PubChem CID 106067078) has the molecular formula C12H12BrFN2O3S and a molecular weight of 363.21 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)-2-methylfuran-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106067078 |
| Molecular Formula | C12H12BrFN2O3S |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)-2-methylfuran-3-sulfonamide |
| SMILES | Cc1oc(CN)cc1S(=O)(=O)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H12BrFN2O3S/c1-7-12(5-9(6-15)19-7)20(17,18)16-8-2-3-10(13)11(14)4-8/h2-5,16H,6,15H2,1H3 |
| InChIKey | CAAIYDMXBIZITH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |