C14H13F2NO4S — CID 75472163
2-(3,4-difluorophenyl)-N-(2,5-dimethylfuran-3-yl)sulfonylacetamide (PubChem CID 75472163) has the molecular formula C14H13F2NO4S and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-(2,5-dimethylfuran-3-yl)sulfonylacetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-(2,5-dimethylfuran-3-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 75472163 |
| Molecular Formula | C14H13F2NO4S |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-(2,5-dimethylfuran-3-yl)sulfonylacetamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)Cc2ccc(F)c(F)c2)c(C)o1 |
| InChI | InChI=1S/C14H13F2NO4S/c1-8-5-13(9(2)21-8)22(19,20)17-14(18)7-10-3-4-11(15)12(16)6-10/h3-6H,7H2,1-2H3,(H,17,18) |
| InChIKey | JSFDWHXFHSUBLF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |