C15H24N2O4S — CID 99614548
(2S)-2-(azepan-1-yl)-N-(2,5-dimethylfuran-3-yl)sulfonylpropanamide (PubChem CID 99614548) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2S)-2-(azepan-1-yl)-N-(2,5-dimethylfuran-3-yl)sulfonylpropanamide.
| Compound Name | (2S)-2-(azepan-1-yl)-N-(2,5-dimethylfuran-3-yl)sulfonylpropanamide |
|---|---|
| PubChem CID | 99614548 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2S)-2-(azepan-1-yl)-N-(2,5-dimethylfuran-3-yl)sulfonylpropanamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)[C@H](C)N2CCCCCC2)c(C)o1 |
| InChI | InChI=1S/C15H24N2O4S/c1-11-10-14(13(3)21-11)22(19,20)16-15(18)12(2)17-8-6-4-5-7-9-17/h10,12H,4-9H2,1-3H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | QDUFIMNXAMQIKI-LBPRGKRZSA-N |
| XLogP | 1.97 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |