C13H11F2NO4S — CID 75472165
N-(2,5-dimethylfuran-3-yl)sulfonyl-2,5-difluorobenzamide (PubChem CID 75472165) has the molecular formula C13H11F2NO4S and a molecular weight of 315.30 g/mol. Its IUPAC name is N-(2,5-dimethylfuran-3-yl)sulfonyl-2,5-difluorobenzamide.
| Compound Name | N-(2,5-dimethylfuran-3-yl)sulfonyl-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 75472165 |
| Molecular Formula | C13H11F2NO4S |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(2,5-dimethylfuran-3-yl)sulfonyl-2,5-difluorobenzamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)c2cc(F)ccc2F)c(C)o1 |
| InChI | InChI=1S/C13H11F2NO4S/c1-7-5-12(8(2)20-7)21(18,19)16-13(17)10-6-9(14)3-4-11(10)15/h3-6H,1-2H3,(H,16,17) |
| InChIKey | VAPJSPVJDYLSGU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |