C13H12FNO4S — CID 86782476
N-(2,5-dimethylfuran-3-yl)sulfonyl-2-fluorobenzamide (PubChem CID 86782476) has the molecular formula C13H12FNO4S and a molecular weight of 297.31 g/mol. Its IUPAC name is N-(2,5-dimethylfuran-3-yl)sulfonyl-2-fluorobenzamide.
| Compound Name | N-(2,5-dimethylfuran-3-yl)sulfonyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 86782476 |
| Molecular Formula | C13H12FNO4S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(2,5-dimethylfuran-3-yl)sulfonyl-2-fluorobenzamide |
| SMILES | Cc1cc(S(=O)(=O)NC(=O)c2ccccc2F)c(C)o1 |
| InChI | InChI=1S/C13H12FNO4S/c1-8-7-12(9(2)19-8)20(17,18)15-13(16)10-5-3-4-6-11(10)14/h3-7H,1-2H3,(H,15,16) |
| InChIKey | IIUFCKPNIODKMA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |