C19H23F3IN3O2S — CID 58133059
N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[2-(dimethylamino)ethylamino]ethanesulfonamide (PubChem CID 58133059) has the molecular formula C19H23F3IN3O2S and a molecular weight of 541.38 g/mol. Its IUPAC name is N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[2-(dimethylamino)ethylamino]ethanesulfonamide.
| Compound Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[2-(dimethylamino)ethylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 58133059 |
| Molecular Formula | C19H23F3IN3O2S |
| Molecular Weight | 541.38 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | N-[3,4-difluoro-2-[(2-fluoro-4-iodophenyl)methyl]phenyl]-2-[2-(dimethylamino)ethylamino]ethanesulfonamide |
| SMILES | CN(C)CCNCCS(=O)(=O)Nc1ccc(F)c(F)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C19H23F3IN3O2S/c1-26(2)9-7-24-8-10-29(27,28)25-18-6-5-16(20)19(22)15(18)11-13-3-4-14(23)12-17(13)21/h3-6,12,24-25H,7-11H2,1-2H3 |
| InChIKey | XCDKKZMBQDEUGF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|