C11H15F3N2O2S — CID 106056316
2-(propylamino)-N-(3,4,5-trifluorophenyl)ethanesulfonamide (PubChem CID 106056316) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-(propylamino)-N-(3,4,5-trifluorophenyl)ethanesulfonamide.
| Compound Name | 2-(propylamino)-N-(3,4,5-trifluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 106056316 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(propylamino)-N-(3,4,5-trifluorophenyl)ethanesulfonamide |
| SMILES | CCCNCCS(=O)(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H15F3N2O2S/c1-2-3-15-4-5-19(17,18)16-8-6-9(12)11(14)10(13)7-8/h6-7,15-16H,2-5H2,1H3 |
| InChIKey | YUSPIADFQQEOBP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|