C10H11ClF3NO2S — CID 116816137
4-chloro-N-(3,4,5-trifluorophenyl)butane-1-sulfonamide (PubChem CID 116816137) has the molecular formula C10H11ClF3NO2S and a molecular weight of 301.72 g/mol. Its IUPAC name is 4-chloro-N-(3,4,5-trifluorophenyl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(3,4,5-trifluorophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116816137 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-chloro-N-(3,4,5-trifluorophenyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H11ClF3NO2S/c11-3-1-2-4-18(16,17)15-7-5-8(12)10(14)9(13)6-7/h5-6,15H,1-4H2 |
| InChIKey | NWLRLEJIHRLBJM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|