C13H19F3N2O2S — CID 106056266
4-(propylamino)-N-(2,3,5-trifluorophenyl)butane-1-sulfonamide (PubChem CID 106056266) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-(propylamino)-N-(2,3,5-trifluorophenyl)butane-1-sulfonamide.
| Compound Name | 4-(propylamino)-N-(2,3,5-trifluorophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106056266 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-(propylamino)-N-(2,3,5-trifluorophenyl)butane-1-sulfonamide |
| SMILES | CCCNCCCCS(=O)(=O)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H19F3N2O2S/c1-2-5-17-6-3-4-7-21(19,20)18-12-9-10(14)8-11(15)13(12)16/h8-9,17-18H,2-7H2,1H3 |
| InChIKey | KQTGKXPYYZDUNS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|