C11H14F3NO2S — CID 65092951
N-(3-ethylsulfonylpropyl)-2,3,5-trifluoroaniline (PubChem CID 65092951) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is N-(3-ethylsulfonylpropyl)-2,3,5-trifluoroaniline.
| Compound Name | N-(3-ethylsulfonylpropyl)-2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 65092951 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(3-ethylsulfonylpropyl)-2,3,5-trifluoroaniline |
| SMILES | CCS(=O)(=O)CCCNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H14F3NO2S/c1-2-18(16,17)5-3-4-15-10-7-8(12)6-9(13)11(10)14/h6-7,15H,2-5H2,1H3 |
| InChIKey | NOAKEUVAYFMJKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|