C11H15F2NO2S — CID 65092780
N-(3-ethylsulfonylpropyl)-2,3-difluoroaniline (PubChem CID 65092780) has the molecular formula C11H15F2NO2S and a molecular weight of 263.31 g/mol. Its IUPAC name is N-(3-ethylsulfonylpropyl)-2,3-difluoroaniline.
| Compound Name | N-(3-ethylsulfonylpropyl)-2,3-difluoroaniline |
|---|---|
| PubChem CID | 65092780 |
| Molecular Formula | C11H15F2NO2S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-(3-ethylsulfonylpropyl)-2,3-difluoroaniline |
| SMILES | CCS(=O)(=O)CCCNc1cccc(F)c1F |
| InChI | InChI=1S/C11H15F2NO2S/c1-2-17(15,16)8-4-7-14-10-6-3-5-9(12)11(10)13/h3,5-6,14H,2,4,7-8H2,1H3 |
| InChIKey | AMTQHASNGTWNMT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|