C13H18F3NO2S — CID 65095652
4-ethylsulfonyl-N-methyl-1-(3,4,5-trifluorophenyl)butan-1-amine (PubChem CID 65095652) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-methyl-1-(3,4,5-trifluorophenyl)butan-1-amine.
| Compound Name | 4-ethylsulfonyl-N-methyl-1-(3,4,5-trifluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 65095652 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-ethylsulfonyl-N-methyl-1-(3,4,5-trifluorophenyl)butan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(NC)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H18F3NO2S/c1-3-20(18,19)6-4-5-12(17-2)9-7-10(14)13(16)11(15)8-9/h7-8,12,17H,3-6H2,1-2H3 |
| InChIKey | ACWWKMLIELBGAR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|