C12H17BrClNO2S — CID 107945284
1-(3-bromo-5-chlorophenyl)-N-methyl-4-methylsulfonylbutan-1-amine (PubChem CID 107945284) has the molecular formula C12H17BrClNO2S and a molecular weight of 354.70 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-N-methyl-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-N-methyl-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 107945284 |
| Molecular Formula | C12H17BrClNO2S |
| Molecular Weight | 354.70 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-N-methyl-4-methylsulfonylbutan-1-amine |
| SMILES | CNC(CCCS(C)(=O)=O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C12H17BrClNO2S/c1-15-12(4-3-5-18(2,16)17)9-6-10(13)8-11(14)7-9/h6-8,12,15H,3-5H2,1-2H3 |
| InChIKey | VBLURACYGFSJJZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |