C11H18N2O2S — CID 63192032
N-methyl-4-methylsulfonyl-1-pyridin-4-ylbutan-1-amine (PubChem CID 63192032) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is N-methyl-4-methylsulfonyl-1-pyridin-4-ylbutan-1-amine.
| Compound Name | N-methyl-4-methylsulfonyl-1-pyridin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 63192032 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-methyl-4-methylsulfonyl-1-pyridin-4-ylbutan-1-amine |
| SMILES | CNC(CCCS(C)(=O)=O)c1ccncc1 |
| InChI | InChI=1S/C11H18N2O2S/c1-12-11(4-3-9-16(2,14)15)10-5-7-13-8-6-10/h5-8,11-12H,3-4,9H2,1-2H3 |
| InChIKey | NXBUIVKJIYIJNP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |