C14H9F4IN2O — CID 89144915
2-[3,4,6-trifluoro-2-(2-fluoro-4-iodoanilino)anilino]acetaldehyde (PubChem CID 89144915) has the molecular formula C14H9F4IN2O and a molecular weight of 424.14 g/mol. Its IUPAC name is 2-[3,4,6-trifluoro-2-(2-fluoro-4-iodoanilino)anilino]acetaldehyde.
| Compound Name | 2-[3,4,6-trifluoro-2-(2-fluoro-4-iodoanilino)anilino]acetaldehyde |
|---|---|
| PubChem CID | 89144915 |
| Molecular Formula | C14H9F4IN2O |
| Molecular Weight | 424.14 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 2-[3,4,6-trifluoro-2-(2-fluoro-4-iodoanilino)anilino]acetaldehyde |
| SMILES | O=CCNc1c(F)cc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H9F4IN2O/c15-8-5-7(19)1-2-11(8)21-14-12(18)9(16)6-10(17)13(14)20-3-4-22/h1-2,4-6,20-21H,3H2 |
| InChIKey | WFMVKHHQSXMNJO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.14 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|