C20H24F3IN2O5S — CID 88960595
N-[3,6-difluoro-2-(2-fluoro-4-iodoanilino)-4-methoxyphenyl]-5,6-dihydroxy-3-methylhexane-3-sulfonamide (PubChem CID 88960595) has the molecular formula C20H24F3IN2O5S and a molecular weight of 588.39 g/mol. Its IUPAC name is N-[3,6-difluoro-2-(2-fluoro-4-iodoanilino)-4-methoxyphenyl]-5,6-dihydroxy-3-methylhexane-3-sulfonamide.
| Compound Name | N-[3,6-difluoro-2-(2-fluoro-4-iodoanilino)-4-methoxyphenyl]-5,6-dihydroxy-3-methylhexane-3-sulfonamide |
|---|---|
| PubChem CID | 88960595 |
| Molecular Formula | C20H24F3IN2O5S |
| Molecular Weight | 588.39 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | N-[3,6-difluoro-2-(2-fluoro-4-iodoanilino)-4-methoxyphenyl]-5,6-dihydroxy-3-methylhexane-3-sulfonamide |
| SMILES | CCC(C)(CC(O)CO)S(=O)(=O)Nc1c(F)cc(OC)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C20H24F3IN2O5S/c1-4-20(2,9-12(28)10-27)32(29,30)26-18-14(22)8-16(31-3)17(23)19(18)25-15-6-5-11(24)7-13(15)21/h5-8,12,25-28H,4,9-10H2,1-3H3 |
| InChIKey | QWJGRVGHTDXSJA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|