C24H31F2IN4O7S — CID 58145963
2-[[4-[bis(2-methoxyethyl)sulfamoyl]morpholin-2-yl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 58145963) has the molecular formula C24H31F2IN4O7S and a molecular weight of 684.50 g/mol. Its IUPAC name is 2-[[4-[bis(2-methoxyethyl)sulfamoyl]morpholin-2-yl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2-[[4-[bis(2-methoxyethyl)sulfamoyl]morpholin-2-yl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 58145963 |
| Molecular Formula | C24H31F2IN4O7S |
| Molecular Weight | 684.50 g/mol |
| Exact Mass | 684.09 |
| IUPAC Name | 2-[[4-[bis(2-methoxyethyl)sulfamoyl]morpholin-2-yl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | COCCN(CCOC)S(=O)(=O)N1CCOC(COc2cc(F)cc(Nc3ccc(I)cc3F)c2C(N)=O)C1 |
| InChI | InChI=1S/C24H31F2IN4O7S/c1-35-8-5-30(6-9-36-2)39(33,34)31-7-10-37-18(14-31)15-38-22-12-16(25)11-21(23(22)24(28)32)29-20-4-3-17(27)13-19(20)26/h3-4,11-13,18,29H,5-10,14-15H2,1-2H3,(H2,28,32) |
| InChIKey | BUBFFJPXFQFJNZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 132.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|