C24H20F4IN3O3S — CID 156808839
5-[[3-(cyclopropylmethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 156808839) has the molecular formula C24H20F4IN3O3S and a molecular weight of 633.41 g/mol. Its IUPAC name is 5-[[3-(cyclopropylmethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 5-[[3-(cyclopropylmethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 156808839 |
| Molecular Formula | C24H20F4IN3O3S |
| Molecular Weight | 633.41 g/mol |
| Exact Mass | 633.02 |
| IUPAC Name | 5-[[3-(cyclopropylmethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | NC(=O)c1cc(Cc2cccc(NS(=O)(=O)CC3CC3)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C24H20F4IN3O3S/c25-17-10-15(29)6-7-18(17)31-23-16(24(30)33)9-14(21(27)22(23)28)8-13-2-1-3-19(20(13)26)32-36(34,35)11-12-4-5-12/h1-3,6-7,9-10,12,31-32H,4-5,8,11H2,(H2,30,33) |
| InChIKey | REOWJUIZCQXSQH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|