C17H20FN3O5S — CID 168675109
tert-butyl 4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]indazole-1-carboxylate (PubChem CID 168675109) has the molecular formula C17H20FN3O5S and a molecular weight of 397.43 g/mol. Its IUPAC name is tert-butyl 4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]indazole-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]indazole-1-carboxylate |
|---|---|
| PubChem CID | 168675109 |
| Molecular Formula | C17H20FN3O5S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | tert-butyl 4-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2c(N3CC(CS(=O)(=O)F)CC3=O)cccc21 |
| InChI | InChI=1S/C17H20FN3O5S/c1-17(2,3)26-16(23)21-14-6-4-5-13(12(14)8-19-21)20-9-11(7-15(20)22)10-27(18,24)25/h4-6,8,11H,7,9-10H2,1-3H3 |
| InChIKey | QAPFCJSPYPCURU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |