C15H13ClFNO3S — CID 168677454
[1-(8-chloronaphthalen-1-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677454) has the molecular formula C15H13ClFNO3S and a molecular weight of 341.79 g/mol. Its IUPAC name is [1-(8-chloronaphthalen-1-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(8-chloronaphthalen-1-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677454 |
| Molecular Formula | C15H13ClFNO3S |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | [1-(8-chloronaphthalen-1-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C15H13ClFNO3S/c16-12-5-1-3-11-4-2-6-13(15(11)12)18-8-10(7-14(18)19)9-22(17,20)21/h1-6,10H,7-9H2 |
| InChIKey | CIGITTVTYUVRHR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |