C12H11FN2O3S — CID 168677255
[1-(2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677255) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is [1-(2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677255 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | [1-(2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | N#Cc1ccccc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H11FN2O3S/c13-19(17,18)8-9-5-12(16)15(7-9)11-4-2-1-3-10(11)6-14/h1-4,9H,5,7-8H2 |
| InChIKey | PDHRCXKGAKDSCW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |