C13H13FN2O3S — CID 168676196
[1-(2-cyano-3-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676196) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is [1-(2-cyano-3-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-cyano-3-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676196 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [1-(2-cyano-3-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1cccc(N2CC(CS(=O)(=O)F)CC2=O)c1C#N |
| InChI | InChI=1S/C13H13FN2O3S/c1-9-3-2-4-12(11(9)6-15)16-7-10(5-13(16)17)8-20(14,18)19/h2-4,10H,5,7-8H2,1H3 |
| InChIKey | ALDXPGQMJDVNJJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |