C11H13FN2O3S — CID 168676206
[1-(6-methyl-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676206) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is [1-(6-methyl-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(6-methyl-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676206 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [1-(6-methyl-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1cccc(N2CC(CS(=O)(=O)F)CC2=O)n1 |
| InChI | InChI=1S/C11H13FN2O3S/c1-8-3-2-4-10(13-8)14-6-9(5-11(14)15)7-18(12,16)17/h2-4,9H,5-7H2,1H3 |
| InChIKey | RXEWVWWQOBGIIO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |