C11H11FN4O3S — CID 168676055
[1-(5-cyano-2-methylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676055) has the molecular formula C11H11FN4O3S and a molecular weight of 298.30 g/mol. Its IUPAC name is [1-(5-cyano-2-methylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(5-cyano-2-methylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676055 |
| Molecular Formula | C11H11FN4O3S |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [1-(5-cyano-2-methylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1ncc(C#N)c(N2CC(CS(=O)(=O)F)CC2=O)n1 |
| InChI | InChI=1S/C11H11FN4O3S/c1-7-14-4-9(3-13)11(15-7)16-5-8(2-10(16)17)6-20(12,18)19/h4,8H,2,5-6H2,1H3 |
| InChIKey | KYJSLGRZKGOYSJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 104.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |