C11H12FN3O5S — CID 168676216
[1-(4-methyl-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676216) has the molecular formula C11H12FN3O5S and a molecular weight of 317.30 g/mol. Its IUPAC name is [1-(4-methyl-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(4-methyl-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676216 |
| Molecular Formula | C11H12FN3O5S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [1-(4-methyl-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1ccnc(N2CC(CS(=O)(=O)F)CC2=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12FN3O5S/c1-7-2-3-13-11(10(7)15(17)18)14-5-8(4-9(14)16)6-21(12,19)20/h2-3,8H,4-6H2,1H3 |
| InChIKey | PCGNVQVAHUIUAY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|