C12H13ClFNO3S — CID 168676191
[1-(2-chloro-6-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676191) has the molecular formula C12H13ClFNO3S and a molecular weight of 305.76 g/mol. Its IUPAC name is [1-(2-chloro-6-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-chloro-6-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676191 |
| Molecular Formula | C12H13ClFNO3S |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | [1-(2-chloro-6-methylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1cccc(Cl)c1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H13ClFNO3S/c1-8-3-2-4-10(13)12(8)15-6-9(5-11(15)16)7-19(14,17)18/h2-4,9H,5-7H2,1H3 |
| InChIKey | WHRWAXJRYLOUOC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |