C13H11ClFN3O3S — CID 168677864
[1-(5-chloroquinazolin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677864) has the molecular formula C13H11ClFN3O3S and a molecular weight of 343.77 g/mol. Its IUPAC name is [1-(5-chloroquinazolin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(5-chloroquinazolin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677864 |
| Molecular Formula | C13H11ClFN3O3S |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | [1-(5-chloroquinazolin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ncc2c(Cl)cccc2n1 |
| InChI | InChI=1S/C13H11ClFN3O3S/c14-10-2-1-3-11-9(10)5-16-13(17-11)18-6-8(4-12(18)19)7-22(15,20)21/h1-3,5,8H,4,6-7H2 |
| InChIKey | GPKHYBVGUNYOGF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |