C13H14ClN3O — CID 168508126
4-(chloromethyl)-1-(1-methylindazol-4-yl)pyrrolidin-2-one (PubChem CID 168508126) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(1-methylindazol-4-yl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(1-methylindazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508126 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-(chloromethyl)-1-(1-methylindazol-4-yl)pyrrolidin-2-one |
| SMILES | Cn1ncc2c(N3CC(CCl)CC3=O)cccc21 |
| InChI | InChI=1S/C13H14ClN3O/c1-16-11-3-2-4-12(10(11)7-15-16)17-8-9(6-14)5-13(17)18/h2-4,7,9H,5-6,8H2,1H3 |
| InChIKey | AXIWZHFVABJSQI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|