C20H23FN4O3 — CID 90757801
tert-butyl 5-amino-4-(2-fluoro-4-methylanilino)-6-methoxyindazole-1-carboxylate (PubChem CID 90757801) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is tert-butyl 5-amino-4-(2-fluoro-4-methylanilino)-6-methoxyindazole-1-carboxylate.
| Compound Name | tert-butyl 5-amino-4-(2-fluoro-4-methylanilino)-6-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 90757801 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl 5-amino-4-(2-fluoro-4-methylanilino)-6-methoxyindazole-1-carboxylate |
| SMILES | COc1cc2c(cnn2C(=O)OC(C)(C)C)c(Nc2ccc(C)cc2F)c1N |
| InChI | InChI=1S/C20H23FN4O3/c1-11-6-7-14(13(21)8-11)24-18-12-10-23-25(19(26)28-20(2,3)4)15(12)9-16(27-5)17(18)22/h6-10,24H,22H2,1-5H3 |
| InChIKey | ZQSCRJYIKNVCLW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|