C18H17FN4O3 — CID 53326697
4-(2-fluoro-4-methylanilino)-6,7-dimethoxycinnoline-3-carboxamide (PubChem CID 53326697) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylanilino)-6,7-dimethoxycinnoline-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-methylanilino)-6,7-dimethoxycinnoline-3-carboxamide |
|---|---|
| PubChem CID | 53326697 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-(2-fluoro-4-methylanilino)-6,7-dimethoxycinnoline-3-carboxamide |
| SMILES | COc1cc2nnc(C(N)=O)c(Nc3ccc(C)cc3F)c2cc1OC |
| InChI | InChI=1S/C18H17FN4O3/c1-9-4-5-12(11(19)6-9)21-16-10-7-14(25-2)15(26-3)8-13(10)22-23-17(16)18(20)24/h4-8H,1-3H3,(H2,20,24)(H,21,22) |
| InChIKey | JVOYTBSMGKEAKW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |