C22H24FIN4O4S2 — CID 25207541
tert-butyl N-[(3S)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 25207541) has the molecular formula C22H24FIN4O4S2 and a molecular weight of 618.49 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 25207541 |
| Molecular Formula | C22H24FIN4O4S2 |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 618.03 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(S(=O)(=O)c2c(Nc3ccc(I)cc3F)sc3ncccc23)C1 |
| InChI | InChI=1S/C22H24FIN4O4S2/c1-22(2,3)32-21(29)26-14-8-10-28(12-14)34(30,31)18-15-5-4-9-25-19(15)33-20(18)27-17-7-6-13(24)11-16(17)23/h4-7,9,11,14,27H,8,10,12H2,1-3H3,(H,26,29)/t14-/m0/s1 |
| InChIKey | ZCTBUJLBVONGJN-AWEZNQCLSA-N |
| XLogP | 5.07 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|