C18H15FIN3O2S — CID 24739365
[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-morpholin-4-ylmethanone (PubChem CID 24739365) has the molecular formula C18H15FIN3O2S and a molecular weight of 483.31 g/mol. Its IUPAC name is [2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 24739365 |
| Molecular Formula | C18H15FIN3O2S |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | [2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1c(Nc2ccc(I)cc2F)sc2ncccc12)N1CCOCC1 |
| InChI | InChI=1S/C18H15FIN3O2S/c19-13-10-11(20)3-4-14(13)22-17-15(12-2-1-5-21-16(12)26-17)18(24)23-6-8-25-9-7-23/h1-5,10,22H,6-9H2 |
| InChIKey | SCFMZUCSJFISAD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|