C16H15F2N3O2 — CID 109228527
[5-(2,4-difluoroanilino)-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 109228527) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is [5-(2,4-difluoroanilino)-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-(2,4-difluoroanilino)-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109228527 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [5-(2,4-difluoroanilino)-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cncc(Nc2ccc(F)cc2F)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H15F2N3O2/c17-12-1-2-15(14(18)8-12)20-13-7-11(9-19-10-13)16(22)21-3-5-23-6-4-21/h1-2,7-10,20H,3-6H2 |
| InChIKey | ZGBLUBKAADXFAN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |