C22H29N3O2 — CID 109228524
[5-[2,6-di(propan-2-yl)anilino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 109228524) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is [5-[2,6-di(propan-2-yl)anilino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-[2,6-di(propan-2-yl)anilino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109228524 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [5-[2,6-di(propan-2-yl)anilino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1cncc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H29N3O2/c1-15(2)19-6-5-7-20(16(3)4)21(19)24-18-12-17(13-23-14-18)22(26)25-8-10-27-11-9-25/h5-7,12-16,24H,8-11H2,1-4H3 |
| InChIKey | RYDWPMHRDNPPNT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |