C18H19F2N3O — CID 109226790
N-cyclohexyl-5-(2,4-difluoroanilino)pyridine-3-carboxamide (PubChem CID 109226790) has the molecular formula C18H19F2N3O and a molecular weight of 331.37 g/mol. Its IUPAC name is N-cyclohexyl-5-(2,4-difluoroanilino)pyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-5-(2,4-difluoroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226790 |
| Molecular Formula | C18H19F2N3O |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-cyclohexyl-5-(2,4-difluoroanilino)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cncc(Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H19F2N3O/c19-13-6-7-17(16(20)9-13)22-15-8-12(10-21-11-15)18(24)23-14-4-2-1-3-5-14/h6-11,14,22H,1-5H2,(H,23,24) |
| InChIKey | SVDOOTRCBQDZRG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |