C15H12F3N3O — CID 109223746
N-cyclopropyl-5-(2,3,4-trifluoroanilino)pyridine-3-carboxamide (PubChem CID 109223746) has the molecular formula C15H12F3N3O and a molecular weight of 307.28 g/mol. Its IUPAC name is N-cyclopropyl-5-(2,3,4-trifluoroanilino)pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-5-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109223746 |
| Molecular Formula | C15H12F3N3O |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-cyclopropyl-5-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
| SMILES | O=C(NC1CC1)c1cncc(Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H12F3N3O/c16-11-3-4-12(14(18)13(11)17)20-10-5-8(6-19-7-10)15(22)21-9-1-2-9/h3-7,9,20H,1-2H2,(H,21,22) |
| InChIKey | UGCZOYHAWGKVNL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|