C18H16FIN4O2S — CID 67312240
[(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]methanone (PubChem CID 67312240) has the molecular formula C18H16FIN4O2S and a molecular weight of 498.32 g/mol. Its IUPAC name is [(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]methanone.
| Compound Name | [(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 67312240 |
| Molecular Formula | C18H16FIN4O2S |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | [(3S,4S)-3-amino-4-hydroxypyrrolidin-1-yl]-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]methanone |
| SMILES | N[C@H]1CN(C(=O)c2c(Nc3ccc(I)cc3F)sc3ncccc23)C[C@@H]1O |
| InChI | InChI=1S/C18H16FIN4O2S/c19-11-6-9(20)3-4-13(11)23-17-15(10-2-1-5-22-16(10)27-17)18(26)24-7-12(21)14(25)8-24/h1-6,12,14,23,25H,7-8,21H2/t12-,14-/m0/s1 |
| InChIKey | IYIBBMCNKBYMQJ-JSGCOSHPSA-N |
| XLogP | 2.93 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|