C18H15FIN3O2S — CID 157178894
(4-amino-1,2-oxazolidin-2-yl)-[2-[(2-fluoro-4-iodophenyl)methyl]thieno[2,3-b]pyridin-3-yl]methanone (PubChem CID 157178894) has the molecular formula C18H15FIN3O2S and a molecular weight of 483.31 g/mol. Its IUPAC name is (4-amino-1,2-oxazolidin-2-yl)-[2-[(2-fluoro-4-iodophenyl)methyl]thieno[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (4-amino-1,2-oxazolidin-2-yl)-[2-[(2-fluoro-4-iodophenyl)methyl]thieno[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 157178894 |
| Molecular Formula | C18H15FIN3O2S |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | (4-amino-1,2-oxazolidin-2-yl)-[2-[(2-fluoro-4-iodophenyl)methyl]thieno[2,3-b]pyridin-3-yl]methanone |
| SMILES | NC1CON(C(=O)c2c(Cc3ccc(I)cc3F)sc3ncccc23)C1 |
| InChI | InChI=1S/C18H15FIN3O2S/c19-14-7-11(20)4-3-10(14)6-15-16(13-2-1-5-22-17(13)26-15)18(24)23-8-12(21)9-25-23/h1-5,7,12H,6,8-9,21H2 |
| InChIKey | LNIZUKWDTVOHMY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|