C12H9ClFIN4O2 — CID 150018018
5-chloro-4-(2-fluoro-4-iodoanilino)-2-hydrazinylpyridine-3-carboxylic acid (PubChem CID 150018018) has the molecular formula C12H9ClFIN4O2 and a molecular weight of 422.59 g/mol. Its IUPAC name is 5-chloro-4-(2-fluoro-4-iodoanilino)-2-hydrazinylpyridine-3-carboxylic acid.
| Compound Name | 5-chloro-4-(2-fluoro-4-iodoanilino)-2-hydrazinylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 150018018 |
| Molecular Formula | C12H9ClFIN4O2 |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 5-chloro-4-(2-fluoro-4-iodoanilino)-2-hydrazinylpyridine-3-carboxylic acid |
| SMILES | NNc1ncc(Cl)c(Nc2ccc(I)cc2F)c1C(=O)O |
| InChI | InChI=1S/C12H9ClFIN4O2/c13-6-4-17-11(19-16)9(12(20)21)10(6)18-8-2-1-5(15)3-7(8)14/h1-4H,16H2,(H,20,21)(H2,17,18,19) |
| InChIKey | DERDFTMBZWQFPL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|