C15H10F3N3OS — CID 88612004
5-[2-(2,4,5-trifluoro-3-methylanilino)phenyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 88612004) has the molecular formula C15H10F3N3OS and a molecular weight of 337.33 g/mol. Its IUPAC name is 5-[2-(2,4,5-trifluoro-3-methylanilino)phenyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(2,4,5-trifluoro-3-methylanilino)phenyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 88612004 |
| Molecular Formula | C15H10F3N3OS |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 5-[2-(2,4,5-trifluoro-3-methylanilino)phenyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1c(F)c(F)cc(Nc2ccccc2-c2n[nH]c(=S)o2)c1F |
| InChI | InChI=1S/C15H10F3N3OS/c1-7-12(17)9(16)6-11(13(7)18)19-10-5-3-2-4-8(10)14-20-21-15(23)22-14/h2-6,19H,1H3,(H,21,23) |
| InChIKey | HZARCBRRANZXJR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|