C18H15ClFN3O — CID 130241061
6-(4-chloro-2-methylanilino)-7-fluoro-3-prop-2-enylbenzimidazole-5-carbaldehyde (PubChem CID 130241061) has the molecular formula C18H15ClFN3O and a molecular weight of 343.79 g/mol. Its IUPAC name is 6-(4-chloro-2-methylanilino)-7-fluoro-3-prop-2-enylbenzimidazole-5-carbaldehyde.
| Compound Name | 6-(4-chloro-2-methylanilino)-7-fluoro-3-prop-2-enylbenzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 130241061 |
| Molecular Formula | C18H15ClFN3O |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 6-(4-chloro-2-methylanilino)-7-fluoro-3-prop-2-enylbenzimidazole-5-carbaldehyde |
| SMILES | C=CCn1cnc2c(F)c(Nc3ccc(Cl)cc3C)c(C=O)cc21 |
| InChI | InChI=1S/C18H15ClFN3O/c1-3-6-23-10-21-18-15(23)8-12(9-24)17(16(18)20)22-14-5-4-13(19)7-11(14)2/h3-5,7-10,22H,1,6H2,2H3 |
| InChIKey | YNPRNSVGGTVYJT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|