C22H22ClFN4O2 — CID 58890640
6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-1-prop-2-enylbenzimidazole-5-carboxamide (PubChem CID 58890640) has the molecular formula C22H22ClFN4O2 and a molecular weight of 428.90 g/mol. Its IUPAC name is 6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-1-prop-2-enylbenzimidazole-5-carboxamide.
| Compound Name | 6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-1-prop-2-enylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58890640 |
| Molecular Formula | C22H22ClFN4O2 |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 6-(4-chloro-2-methylanilino)-N-(cyclopropylmethoxy)-7-fluoro-1-prop-2-enylbenzimidazole-5-carboxamide |
| SMILES | C=CCn1cnc2cc(C(=O)NOCC3CC3)c(Nc3ccc(Cl)cc3C)c(F)c21 |
| InChI | InChI=1S/C22H22ClFN4O2/c1-3-8-28-12-25-18-10-16(22(29)27-30-11-14-4-5-14)20(19(24)21(18)28)26-17-7-6-15(23)9-13(17)2/h3,6-7,9-10,12,14,26H,1,4-5,8,11H2,2H3,(H,27,29) |
| InChIKey | HFXJPEVIDTXKFU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|